C35H49N3O7 — CID 23756951
[(2R)-2-[[(1S,2S,5R,6R,7R)-3-(4-hydroxybutyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate (PubChem CID 23756951) has the molecular formula C35H49N3O7 and a molecular weight of 623.79 g/mol. Its IUPAC name is [(2R)-2-[[(1S,2S,5R,6R,7R)-3-(4-hydroxybutyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate.
| Compound Name | [(2R)-2-[[(1S,2S,5R,6R,7R)-3-(4-hydroxybutyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
|---|---|
| PubChem CID | 23756951 |
| Molecular Formula | C35H49N3O7 |
| Molecular Weight | 623.79 g/mol |
| Exact Mass | 623.36 |
| IUPAC Name | [(2R)-2-[[(1S,2S,5R,6R,7R)-3-(4-hydroxybutyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@H](NC(=O)[C@@H]1[C@H]2C(=O)N(CCCCO)[C@H](C(=O)N(CC=C)CCCCC)[C@]23CC[C@H]1O3)c1ccccc1 |
| InChI | InChI=1S/C35H49N3O7/c1-4-7-12-21-37(20-6-3)34(43)31-35-19-18-27(45-35)29(30(35)33(42)38(31)22-13-14-23-39)32(41)36-26(25-15-10-9-11-16-25)24-44-28(40)17-8-5-2/h5-6,9-11,15-16,26-27,29-31,39H,2-4,7-8,12-14,17-24H2,1H3,(H,36,41)/t26-,27+,29-,30-,31+,35-/m0/s1 |
| InChIKey | HAKXLQRHSPYXFZ-FXLZARRYSA-N |
| XLogP | 3.71 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.79 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|