C34H47N3O7 — CID 23927612
[(2R)-2-[[(1R,2R,5S,6S,7S)-3-(3-hydroxypropyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate (PubChem CID 23927612) has the molecular formula C34H47N3O7 and a molecular weight of 609.76 g/mol. Its IUPAC name is [(2R)-2-[[(1R,2R,5S,6S,7S)-3-(3-hydroxypropyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate.
| Compound Name | [(2R)-2-[[(1R,2R,5S,6S,7S)-3-(3-hydroxypropyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
|---|---|
| PubChem CID | 23927612 |
| Molecular Formula | C34H47N3O7 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | [(2R)-2-[[(1R,2R,5S,6S,7S)-3-(3-hydroxypropyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@H](NC(=O)[C@@H]1[C@@H]2CC[C@]3(O2)[C@H](C(=O)N(CC=C)CCCCC)N(CCCO)C(=O)[C@@H]13)c1ccccc1 |
| InChI | InChI=1S/C34H47N3O7/c1-4-7-12-20-36(19-6-3)33(42)30-34-18-17-26(44-34)28(29(34)32(41)37(30)21-13-22-38)31(40)35-25(24-14-10-9-11-15-24)23-43-27(39)16-8-5-2/h5-6,9-11,14-15,25-26,28-30,38H,2-4,7-8,12-13,16-23H2,1H3,(H,35,40)/t25-,26-,28+,29+,30-,34+/m0/s1 |
| InChIKey | WMXUPKJMFDQNHA-UVJPHPQZSA-N |
| XLogP | 3.32 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|