C32H43N3O7 — CID 23756719
[(2R)-2-[[(1S,2S,5R,6R,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate (PubChem CID 23756719) has the molecular formula C32H43N3O7 and a molecular weight of 581.71 g/mol. Its IUPAC name is [(2R)-2-[[(1S,2S,5R,6R,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate.
| Compound Name | [(2R)-2-[[(1S,2S,5R,6R,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
|---|---|
| PubChem CID | 23756719 |
| Molecular Formula | C32H43N3O7 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | [(2R)-2-[[(1S,2S,5R,6R,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carbonyl]amino]-2-phenylethyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@H](NC(=O)[C@@H]1[C@H]2C(=O)N(CCO)[C@H](C(=O)N(CC=C)CCCC)[C@]23CC[C@H]1O3)c1ccccc1 |
| InChI | InChI=1S/C32H43N3O7/c1-4-7-14-25(37)41-21-23(22-12-10-9-11-13-22)33-29(38)26-24-15-16-32(42-24)27(26)30(39)35(19-20-36)28(32)31(40)34(17-6-3)18-8-5-2/h4,6,9-13,23-24,26-28,36H,1,3,5,7-8,14-21H2,2H3,(H,33,38)/t23-,24+,26-,27-,28+,32-/m0/s1 |
| InChIKey | XIBMJVXXPNZYQZ-HGWFHWNMSA-N |
| XLogP | 2.53 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|