C28H27N5O7 — CID 23792219
3-[[3-[(2-methoxy-2-oxoethyl)amino]-2-(2-phenylethyl)imidazo[1,2-a]pyridine-8-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid (PubChem CID 23792219) has the molecular formula C28H27N5O7 and a molecular weight of 545.55 g/mol. Its IUPAC name is 3-[[3-[(2-methoxy-2-oxoethyl)amino]-2-(2-phenylethyl)imidazo[1,2-a]pyridine-8-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid.
| Compound Name | 3-[[3-[(2-methoxy-2-oxoethyl)amino]-2-(2-phenylethyl)imidazo[1,2-a]pyridine-8-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 23792219 |
| Molecular Formula | C28H27N5O7 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 3-[[3-[(2-methoxy-2-oxoethyl)amino]-2-(2-phenylethyl)imidazo[1,2-a]pyridine-8-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
| SMILES | COC(=O)CNc1c(CCc2ccccc2)nc2c(C(=O)NC(CC(=O)O)c3cccc([N+](=O)[O-])c3)cccn12 |
| InChI | InChI=1S/C28H27N5O7/c1-40-25(36)17-29-27-22(13-12-18-7-3-2-4-8-18)30-26-21(11-6-14-32(26)27)28(37)31-23(16-24(34)35)19-9-5-10-20(15-19)33(38)39/h2-11,14-15,23,29H,12-13,16-17H2,1H3,(H,31,37)(H,34,35) |
| InChIKey | UQFWRVLBFGMUJU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|