C24H27N5O7 — CID 23996046
3-[[3-[(2-ethoxy-2-oxoethyl)amino]-2-propan-2-ylimidazo[1,2-a]pyridine-8-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid (PubChem CID 23996046) has the molecular formula C24H27N5O7 and a molecular weight of 497.51 g/mol. Its IUPAC name is 3-[[3-[(2-ethoxy-2-oxoethyl)amino]-2-propan-2-ylimidazo[1,2-a]pyridine-8-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid.
| Compound Name | 3-[[3-[(2-ethoxy-2-oxoethyl)amino]-2-propan-2-ylimidazo[1,2-a]pyridine-8-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 23996046 |
| Molecular Formula | C24H27N5O7 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 3-[[3-[(2-ethoxy-2-oxoethyl)amino]-2-propan-2-ylimidazo[1,2-a]pyridine-8-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
| SMILES | CCOC(=O)CNc1c(C(C)C)nc2c(C(=O)NC(CC(=O)O)c3cccc([N+](=O)[O-])c3)cccn12 |
| InChI | InChI=1S/C24H27N5O7/c1-4-36-20(32)13-25-23-21(14(2)3)27-22-17(9-6-10-28(22)23)24(33)26-18(12-19(30)31)15-7-5-8-16(11-15)29(34)35/h5-11,14,18,25H,4,12-13H2,1-3H3,(H,26,33)(H,30,31) |
| InChIKey | FGIZCFNNOGZQIH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|