C20H20ClN3O6S — CID 90485620
ethyl 3-(3-nitrophenyl)-3-[[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]propanoate;hydrochloride (PubChem CID 90485620) has the molecular formula C20H20ClN3O6S and a molecular weight of 465.92 g/mol. Its IUPAC name is ethyl 3-(3-nitrophenyl)-3-[[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]propanoate;hydrochloride.
| Compound Name | ethyl 3-(3-nitrophenyl)-3-[[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 90485620 |
| Molecular Formula | C20H20ClN3O6S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | ethyl 3-(3-nitrophenyl)-3-[[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)CC(NC(=O)Cn1c(=O)sc2ccccc21)c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C20H19N3O6S.ClH/c1-2-29-19(25)11-15(13-6-5-7-14(10-13)23(27)28)21-18(24)12-22-16-8-3-4-9-17(16)30-20(22)26;/h3-10,15H,2,11-12H2,1H3,(H,21,24);1H |
| InChIKey | XZCXLYULRSCRQJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|