C21H25N5O8S — CID 23793787
4-(diethylamino)-N-(4-morpholin-4-ylsulfonylphenyl)-3,5-dinitrobenzamide (PubChem CID 23793787) has the molecular formula C21H25N5O8S and a molecular weight of 507.53 g/mol. Its IUPAC name is 4-(diethylamino)-N-(4-morpholin-4-ylsulfonylphenyl)-3,5-dinitrobenzamide.
| Compound Name | 4-(diethylamino)-N-(4-morpholin-4-ylsulfonylphenyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 23793787 |
| Molecular Formula | C21H25N5O8S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 4-(diethylamino)-N-(4-morpholin-4-ylsulfonylphenyl)-3,5-dinitrobenzamide |
| SMILES | CCN(CC)c1c([N+](=O)[O-])cc(C(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25N5O8S/c1-3-23(4-2)20-18(25(28)29)13-15(14-19(20)26(30)31)21(27)22-16-5-7-17(8-6-16)35(32,33)24-9-11-34-12-10-24/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,22,27) |
| InChIKey | CKNLDGZVVIZPPK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|