C28H30N4O7S2 — CID 23796596
[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]benzoate (PubChem CID 23796596) has the molecular formula C28H30N4O7S2 and a molecular weight of 598.70 g/mol. Its IUPAC name is [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]benzoate.
| Compound Name | [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]benzoate |
|---|---|
| PubChem CID | 23796596 |
| Molecular Formula | C28H30N4O7S2 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]benzoate |
| SMILES | CC1(C)CC2CC(C)(CN2S(=O)(=O)c2cccc(C(=O)OCC(=O)Nc3nc(-c4cccc([N+](=O)[O-])c4)cs3)c2)C1 |
| InChI | InChI=1S/C28H30N4O7S2/c1-27(2)12-21-13-28(3,16-27)17-31(21)41(37,38)22-9-5-7-19(11-22)25(34)39-14-24(33)30-26-29-23(15-40-26)18-6-4-8-20(10-18)32(35)36/h4-11,15,21H,12-14,16-17H2,1-3H3,(H,29,30,33) |
| InChIKey | QGGWEVGWRFXOKT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|