C22H23N3O5S2 — CID 2361840
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 3-(diethylsulfamoyl)benzoate (PubChem CID 2361840) has the molecular formula C22H23N3O5S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2361840 |
| Molecular Formula | C22H23N3O5S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C22H23N3O5S2/c1-3-25(4-2)32(28,29)18-12-8-11-17(13-18)21(27)30-14-20(26)24-22-23-19(15-31-22)16-9-6-5-7-10-16/h5-13,15H,3-4,14H2,1-2H3,(H,23,24,26) |
| InChIKey | JNSHGBHMYOMUDM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |