C24H38N2O3S — CID 23796833
3-methyl-N-[3-(morpholine-4-carbonyl)-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl]butanamide (PubChem CID 23796833) has the molecular formula C24H38N2O3S and a molecular weight of 434.65 g/mol. Its IUPAC name is 3-methyl-N-[3-(morpholine-4-carbonyl)-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl]butanamide.
| Compound Name | 3-methyl-N-[3-(morpholine-4-carbonyl)-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl]butanamide |
|---|---|
| PubChem CID | 23796833 |
| Molecular Formula | C24H38N2O3S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 3-methyl-N-[3-(morpholine-4-carbonyl)-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl]butanamide |
| SMILES | CC(C)CC(=O)Nc1sc2c(c1C(=O)N1CCOCC1)CCCCCCCCCC2 |
| InChI | InChI=1S/C24H38N2O3S/c1-18(2)17-21(27)25-23-22(24(28)26-13-15-29-16-14-26)19-11-9-7-5-3-4-6-8-10-12-20(19)30-23/h18H,3-17H2,1-2H3,(H,25,27) |
| InChIKey | HPVXTYAWKMMHTI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |