C17H23N3O7S — CID 2829805
2-[(2-morpholin-4-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;oxalic acid (PubChem CID 2829805) has the molecular formula C17H23N3O7S and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-[(2-morpholin-4-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;oxalic acid.
| Compound Name | 2-[(2-morpholin-4-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 2829805 |
| Molecular Formula | C17H23N3O7S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-[(2-morpholin-4-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;oxalic acid |
| SMILES | NC(=O)c1c(NC(=O)CN2CCOCC2)sc2c1CCCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H21N3O3S.C2H2O4/c16-14(20)13-10-3-1-2-4-11(10)22-15(13)17-12(19)9-18-5-7-21-8-6-18;3-1(4)2(5)6/h1-9H2,(H2,16,20)(H,17,19);(H,3,4)(H,5,6) |
| InChIKey | PDPILCCWVXTNPR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|