C12H12ClF3N2OS2 — CID 2379748
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 2379748) has the molecular formula C12H12ClF3N2OS2 and a molecular weight of 356.82 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 2379748 |
| Molecular Formula | C12H12ClF3N2OS2 |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12ClF3N2OS2/c1-18(2)11(20)21-6-10(19)17-7-3-4-9(13)8(5-7)12(14,15)16/h3-5H,6H2,1-2H3,(H,17,19) |
| InChIKey | RLMSBLQRAAKASA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|