C12H13F3N2OS2 — CID 2477387
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] N,N-dimethylcarbamodithioate (PubChem CID 2477387) has the molecular formula C12H13F3N2OS2 and a molecular weight of 322.38 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 2477387 |
| Molecular Formula | C12H13F3N2OS2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2OS2/c1-17(2)11(19)20-7-10(18)16-9-5-3-4-8(6-9)12(13,14)15/h3-6H,7H2,1-2H3,(H,16,18) |
| InChIKey | WMCSGQUFAPNHCU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|