C21H23N5O6 — CID 23798692
3-[[5-(cyclopropanecarbonyl)-3-[(2-nitrophenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carbonyl]amino]propanoic acid (PubChem CID 23798692) has the molecular formula C21H23N5O6 and a molecular weight of 441.44 g/mol. Its IUPAC name is 3-[[5-(cyclopropanecarbonyl)-3-[(2-nitrophenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-(cyclopropanecarbonyl)-3-[(2-nitrophenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23798692 |
| Molecular Formula | C21H23N5O6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 3-[[5-(cyclopropanecarbonyl)-3-[(2-nitrophenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C1Cc2ncn(Cc3ccccc3[N+](=O)[O-])c2CN1C(=O)C1CC1 |
| InChI | InChI=1S/C21H23N5O6/c27-19(28)7-8-22-20(29)17-9-15-18(11-25(17)21(30)13-5-6-13)24(12-23-15)10-14-3-1-2-4-16(14)26(31)32/h1-4,12-13,17H,5-11H2,(H,22,29)(H,27,28) |
| InChIKey | VREJTYOSQGHRAQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|