C24H30N6O4 — CID 23964060
N-(2-aminocyclohexyl)-5-(cyclopropanecarbonyl)-3-[(4-nitrophenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxamide (PubChem CID 23964060) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)-5-(cyclopropanecarbonyl)-3-[(4-nitrophenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxamide.
| Compound Name | N-(2-aminocyclohexyl)-5-(cyclopropanecarbonyl)-3-[(4-nitrophenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 23964060 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | N-(2-aminocyclohexyl)-5-(cyclopropanecarbonyl)-3-[(4-nitrophenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxamide |
| SMILES | NC1CCCCC1NC(=O)C1Cc2ncn(Cc3ccc([N+](=O)[O-])cc3)c2CN1C(=O)C1CC1 |
| InChI | InChI=1S/C24H30N6O4/c25-18-3-1-2-4-19(18)27-23(31)21-11-20-22(13-29(21)24(32)16-7-8-16)28(14-26-20)12-15-5-9-17(10-6-15)30(33)34/h5-6,9-10,14,16,18-19,21H,1-4,7-8,11-13,25H2,(H,27,31) |
| InChIKey | XGKQIGVLQCCBRO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|