C23H29N5O3 — CID 42857574
N-[6-[4-[(4-nitrophenyl)methyl]-1,4-diazepan-1-yl]-3-pyridinyl]cyclopentanecarboxamide (PubChem CID 42857574) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[6-[4-[(4-nitrophenyl)methyl]-1,4-diazepan-1-yl]-3-pyridinyl]cyclopentanecarboxamide.
| Compound Name | N-[6-[4-[(4-nitrophenyl)methyl]-1,4-diazepan-1-yl]-3-pyridinyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42857574 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-[6-[4-[(4-nitrophenyl)methyl]-1,4-diazepan-1-yl]-3-pyridinyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCCN(Cc3ccc([N+](=O)[O-])cc3)CC2)nc1)C1CCCC1 |
| InChI | InChI=1S/C23H29N5O3/c29-23(19-4-1-2-5-19)25-20-8-11-22(24-16-20)27-13-3-12-26(14-15-27)17-18-6-9-21(10-7-18)28(30)31/h6-11,16,19H,1-5,12-15,17H2,(H,25,29) |
| InChIKey | IGERXQLLIJRWQG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|