C23H30N4O2 — CID 42857578
N-[6-[4-[(2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]-3-pyridinyl]cyclopentanecarboxamide (PubChem CID 42857578) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[6-[4-[(2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]-3-pyridinyl]cyclopentanecarboxamide.
| Compound Name | N-[6-[4-[(2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]-3-pyridinyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42857578 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[6-[4-[(2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]-3-pyridinyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCCN(Cc3ccccc3O)CC2)nc1)C1CCCC1 |
| InChI | InChI=1S/C23H30N4O2/c28-21-9-4-3-8-19(21)17-26-12-5-13-27(15-14-26)22-11-10-20(16-24-22)25-23(29)18-6-1-2-7-18/h3-4,8-11,16,18,28H,1-2,5-7,12-15,17H2,(H,25,29) |
| InChIKey | MWBGDAINVSCZNR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|