C30H27N5O8 — CID 14403552
(6S)-5-[2,2-bis(4-nitrophenyl)acetyl]-1-[(4-methoxy-3-methylphenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylic acid (PubChem CID 14403552) has the molecular formula C30H27N5O8 and a molecular weight of 585.57 g/mol. Its IUPAC name is (6S)-5-[2,2-bis(4-nitrophenyl)acetyl]-1-[(4-methoxy-3-methylphenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylic acid.
| Compound Name | (6S)-5-[2,2-bis(4-nitrophenyl)acetyl]-1-[(4-methoxy-3-methylphenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 14403552 |
| Molecular Formula | C30H27N5O8 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | (6S)-5-[2,2-bis(4-nitrophenyl)acetyl]-1-[(4-methoxy-3-methylphenyl)methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylic acid |
| SMILES | COc1ccc(Cn2cnc3c2C[C@@H](C(=O)O)N(C(=O)C(c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)C3)cc1C |
| InChI | InChI=1S/C30H27N5O8/c1-18-13-19(3-12-27(18)43-2)15-32-17-31-24-16-33(26(30(37)38)14-25(24)32)29(36)28(20-4-8-22(9-5-20)34(39)40)21-6-10-23(11-7-21)35(41)42/h3-13,17,26,28H,14-16H2,1-2H3,(H,37,38)/t26-/m0/s1 |
| InChIKey | AVMRCXMMAIVHAS-SANMLTNESA-N |
| XLogP | 4.23 |
| TPSA | 170.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|