C34H35N3O5S — CID 23802767
[2-[(3-ethoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylate (PubChem CID 23802767) has the molecular formula C34H35N3O5S and a molecular weight of 597.74 g/mol. Its IUPAC name is [2-[(3-ethoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylate.
| Compound Name | [2-[(3-ethoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylate |
|---|---|
| PubChem CID | 23802767 |
| Molecular Formula | C34H35N3O5S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | [2-[(3-ethoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2c3c(nc4ccccc24)CCN(Cc2ccccc2)C3)sc2c1CCCCC2 |
| InChI | InChI=1S/C34H35N3O5S/c1-2-41-34(40)31-24-14-7-4-8-16-28(24)43-32(31)36-29(38)21-42-33(39)30-23-13-9-10-15-26(23)35-27-17-18-37(20-25(27)30)19-22-11-5-3-6-12-22/h3,5-6,9-13,15H,2,4,7-8,14,16-21H2,1H3,(H,36,38) |
| InChIKey | HYAQXIPVQMUSJP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |