C28H30N2O5S — CID 23791179
[2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 23791179) has the molecular formula C28H30N2O5S and a molecular weight of 506.62 g/mol. Its IUPAC name is [2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 23791179 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | [2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2c3c(nc4ccccc24)CCC(C)C3)sc2c1CCCC2 |
| InChI | InChI=1S/C28H30N2O5S/c1-3-34-28(33)25-18-9-5-7-11-22(18)36-26(25)30-23(31)15-35-27(32)24-17-8-4-6-10-20(17)29-21-13-12-16(2)14-19(21)24/h4,6,8,10,16H,3,5,7,9,11-15H2,1-2H3,(H,30,31) |
| InChIKey | OFKKZUYTUDQFSG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |