C31H35N3O3S — CID 23885724
[2-[[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 23885724) has the molecular formula C31H35N3O3S and a molecular weight of 529.71 g/mol. Its IUPAC name is [2-[[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-[[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 23885724 |
| Molecular Formula | C31H35N3O3S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | [2-[[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CCC(C)(C)C1CCc2c(sc(NC(=O)COC(=O)c3c4c(nc5ccccc35)CCC(C)C4)c2C#N)C1 |
| InChI | InChI=1S/C31H35N3O3S/c1-5-31(3,4)19-11-12-20-23(16-32)29(38-26(20)15-19)34-27(35)17-37-30(36)28-21-8-6-7-9-24(21)33-25-13-10-18(2)14-22(25)28/h6-9,18-19H,5,10-15,17H2,1-4H3,(H,34,35) |
| InChIKey | UDRODUJHVQXDRW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |