C31H27N3O3S — CID 23742511
[2-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 23742511) has the molecular formula C31H27N3O3S and a molecular weight of 521.64 g/mol. Its IUPAC name is [2-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 23742511 |
| Molecular Formula | C31H27N3O3S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | [2-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | N#Cc1c(NC(=O)COC(=O)c2c3c(nc4ccccc24)CCCC3)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C31H27N3O3S/c32-17-24-21-15-14-20(19-8-2-1-3-9-19)16-27(21)38-30(24)34-28(35)18-37-31(36)29-22-10-4-6-12-25(22)33-26-13-7-5-11-23(26)29/h1-4,6,8-10,12,20H,5,7,11,13-16,18H2,(H,34,35) |
| InChIKey | GPDGWAXGHWXLOU-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |