C10H11N3S2 — CID 2380517
5-(3,4-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 2380517) has the molecular formula C10H11N3S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 5-(3,4-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(3,4-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 2380517 |
| Molecular Formula | C10H11N3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 5-(3,4-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1ccc(Nc2n[nH]c(=S)s2)cc1C |
| InChI | InChI=1S/C10H11N3S2/c1-6-3-4-8(5-7(6)2)11-9-12-13-10(14)15-9/h3-5H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | RNCSODFVQZANEB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|