C12H9N3S2 — CID 2730997
5-(naphthalen-1-ylamino)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 2730997) has the molecular formula C12H9N3S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 5-(naphthalen-1-ylamino)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(naphthalen-1-ylamino)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 2730997 |
| Molecular Formula | C12H9N3S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 5-(naphthalen-1-ylamino)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(Nc2cccc3ccccc23)s1 |
| InChI | InChI=1S/C12H9N3S2/c16-12-15-14-11(17-12)13-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,13,14)(H,15,16) |
| InChIKey | KVUKMOJONYGVNE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|