C13H16O4 — CID 23807583
(E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid (PubChem CID 23807583) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid.
| Compound Name | (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid |
|---|---|
| PubChem CID | 23807583 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid |
| SMILES | CC(C)(/C=C/C(=O)O)[C@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H16O4/c1-13(2,8-7-11(15)16)12(17)9-3-5-10(14)6-4-9/h3-8,12,14,17H,1-2H3,(H,15,16)/b8-7+/t12-/m1/s1 |
| InChIKey | MMGBIAIPTCQCAK-ABZNLYFFSA-N |
| XLogP | 2.09 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|