About (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid
(E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid (PubChem CID 23807583) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid.
Molecular Properties
| Compound Name | (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid |
| PubChem CID | 23807583 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid |
| SMILES | CC(C)(/C=C/C(=O)O)[C@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H16O4/c1-13(2,8-7-11(15)16)12(17)9-3-5-10(14)6-4-9/h3-8,12,14,17H,1-2H3,(H,15,16)/b8-7+/t12-/m1/s1 |
| InChIKey | MMGBIAIPTCQCAK-ABZNLYFFSA-N |
| XLogP | 2.09 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid?
The IUPAC name of (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid (CID 23807583) is (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid.
What is the SMILES notation for (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid?
The canonical SMILES for (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid is CC(C)(/C=C/C(=O)O)[C@H](O)c1ccc(O)cc1.
What is the InChIKey of (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid?
The InChIKey is MMGBIAIPTCQCAK-ABZNLYFFSA-N. The full InChI is InChI=1S/C13H16O4/c1-13(2,8-7-11(15)16)12(17)9-3-5-10(14)6-4-9/h3-8,12,14,17H,1-2H3,(H,15,16)/b8-7+/t12-/m1/s1.
What are the key properties of (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid?
(E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid has a molecular weight of 236.27 g/mol, XLogP of 2.09, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,5S)-5-hydroxy-5-(4-hydroxyphenyl)-4,4-dimethylpent-2-enoic acid is sourced from PubChem (CID 23807583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).