C21H17Cl2FN2OS — CID 2381155
N-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[3,2-a]azepine-9-carboxamide (PubChem CID 2381155) has the molecular formula C21H17Cl2FN2OS and a molecular weight of 435.35 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[3,2-a]azepine-9-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[3,2-a]azepine-9-carboxamide |
|---|---|
| PubChem CID | 2381155 |
| Molecular Formula | C21H17Cl2FN2OS |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[3,2-a]azepine-9-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C1=C2SC=C(c3ccc(F)cc3)N2CCCC1 |
| InChI | InChI=1S/C21H17Cl2FN2OS/c22-17-9-8-15(11-18(17)23)25-20(27)16-3-1-2-10-26-19(12-28-21(16)26)13-4-6-14(24)7-5-13/h4-9,11-12H,1-3,10H2,(H,25,27) |
| InChIKey | BCDWRIUVKQPZBL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |