C37H46BrN3O4S — CID 23812857
(5S,6R,7R)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812857) has the molecular formula C37H46BrN3O4S and a molecular weight of 708.76 g/mol. Its IUPAC name is (5S,6R,7R)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812857 |
| Molecular Formula | C37H46BrN3O4S |
| Molecular Weight | 708.76 g/mol |
| Exact Mass | 707.24 |
| IUPAC Name | (5S,6R,7R)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)Cc3ccccc3)C(C(=O)N(CC=C)C(C)CCC)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C37H46BrN3O4S/c1-5-14-25(4)40(20-7-3)36(45)33-37-22-29(38)32(46-37)30(34(43)39(19-6-2)23-27-17-12-9-13-18-27)31(37)35(44)41(33)28(24-42)21-26-15-10-8-11-16-26/h6-13,15-18,25,28-33,42H,2-3,5,14,19-24H2,1,4H3/t25?,28-,29?,30+,31+,32+,33?,37?/m1/s1 |
| InChIKey | NDLWKZUPJGBFTO-GESFQYJXSA-N |
| XLogP | 5.47 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|