C38H42BrN3O5 — CID 23813541
(5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813541) has the molecular formula C38H42BrN3O5 and a molecular weight of 700.67 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813541 |
| Molecular Formula | C38H42BrN3O5 |
| Molecular Weight | 700.67 g/mol |
| Exact Mass | 699.23 |
| IUPAC Name | (5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N([C@@H](CO)CC(C)C)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccccc3)[C@H]3OC12CC3Br)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C38H42BrN3O5/c1-5-18-40(27-14-8-7-9-15-27)35(44)31-32-36(45)42(29(23-43)20-24(3)4)34(38(32)22-30(39)33(31)47-38)37(46)41(19-6-2)28-17-16-25-12-10-11-13-26(25)21-28/h5-17,21,24,29-34,43H,1-2,18-20,22-23H2,3-4H3/t29-,30?,31+,32+,33+,34?,38?/m1/s1 |
| InChIKey | WGQXHLFZGHKXOG-CVVAXYACSA-N |
| XLogP | 5.73 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|