C32H44BrN3O6 — CID 23870366
(5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870366) has the molecular formula C32H44BrN3O6 and a molecular weight of 646.62 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870366 |
| Molecular Formula | C32H44BrN3O6 |
| Molecular Weight | 646.62 g/mol |
| Exact Mass | 645.24 |
| IUPAC Name | (5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)CC(C)C)C(C(=O)N(CC=C)c3ccc(OC)cc3)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C32H44BrN3O6/c1-7-14-34(15-8-2)29(38)25-26-30(39)36(22(19-37)17-20(4)5)28(32(26)18-24(33)27(25)42-32)31(40)35(16-9-3)21-10-12-23(41-6)13-11-21/h7,9-13,20,22,24-28,37H,1,3,8,14-19H2,2,4-6H3/t22-,24?,25+,26+,27+,28?,32?/m1/s1 |
| InChIKey | WOUPNUPXHGBYQZ-KAQCEECMSA-N |
| XLogP | 3.79 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|