C29H39BrN2O6 — CID 23978655
ethyl (5R,6S,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23978655) has the molecular formula C29H39BrN2O6 and a molecular weight of 591.54 g/mol. Its IUPAC name is ethyl (5R,6S,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23978655 |
| Molecular Formula | C29H39BrN2O6 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | ethyl (5R,6S,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N([C@@H](CO)CC(C)C)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@H]3OC12CC3Br)c1c(C)cccc1C |
| InChI | InChI=1S/C29H39BrN2O6/c1-7-12-31(23-17(5)10-9-11-18(23)6)27(35)25-29-14-20(30)24(38-29)21(28(36)37-8-2)22(29)26(34)32(25)19(15-33)13-16(3)4/h7,9-11,16,19-22,24-25,33H,1,8,12-15H2,2-6H3/t19-,20?,21+,22+,24+,25?,29?/m1/s1 |
| InChIKey | VSJJHMNCAWQSCG-ALYPNKRNSA-N |
| XLogP | 3.54 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|