C35H42BrN3O5 — CID 23898199
(5R,6R,7S)-6-N-benzyl-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898199) has the molecular formula C35H42BrN3O5 and a molecular weight of 664.64 g/mol. Its IUPAC name is (5R,6R,7S)-6-N-benzyl-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-6-N-benzyl-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898199 |
| Molecular Formula | C35H42BrN3O5 |
| Molecular Weight | 664.64 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | (5R,6R,7S)-6-N-benzyl-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2c(C)cccc2C)N([C@@H](CC)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C35H42BrN3O5/c1-6-17-37(20-24-15-10-9-11-16-24)32(41)27-28-33(42)39(25(8-3)21-40)31(35(28)19-26(36)30(27)44-35)34(43)38(18-7-2)29-22(4)13-12-14-23(29)5/h6-7,9-16,25-28,30-31,40H,1-2,8,17-21H2,3-5H3/t25-,26?,27+,28-,30+,31?,35?/m0/s1 |
| InChIKey | FTIDVMPSJJEYIS-XCXJYOBMSA-N |
| XLogP | 4.56 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|