C37H46BrN3O5 — CID 23784465
(5R,6S,7R)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23784465) has the molecular formula C37H46BrN3O5 and a molecular weight of 692.70 g/mol. Its IUPAC name is (5R,6S,7R)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23784465 |
| Molecular Formula | C37H46BrN3O5 |
| Molecular Weight | 692.70 g/mol |
| Exact Mass | 691.26 |
| IUPAC Name | (5R,6S,7R)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCCCC)C(=O)C1N([C@@H](CO)Cc2ccccc2)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)Cc3ccccc3)[C@H]3OC12CC3Br |
| InChI | InChI=1S/C37H46BrN3O5/c1-4-7-14-21-39(19-5-2)36(45)33-37-23-29(38)32(46-37)30(34(43)40(20-6-3)24-27-17-12-9-13-18-27)31(37)35(44)41(33)28(25-42)22-26-15-10-8-11-16-26/h5-6,8-13,15-18,28-33,42H,2-4,7,14,19-25H2,1H3/t28-,29?,30+,31+,32+,33?,37?/m1/s1 |
| InChIKey | KXSWKLRUKSHRAF-LKYIIQDVSA-N |
| XLogP | 4.76 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|