C29H31BrN2O6 — CID 23843349
(1R,2R,5S,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23843349) has the molecular formula C29H31BrN2O6 and a molecular weight of 583.48 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (1R,2R,5S,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23843349 |
| Molecular Formula | C29H31BrN2O6 |
| Molecular Weight | 583.48 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | (1R,2R,5S,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1N([C@@H](CO)Cc2ccccc2)C(=O)[C@H]2[C@H](C(=O)O)[C@H]3O[C@@]12CC3Br |
| InChI | InChI=1S/C29H31BrN2O6/c1-2-13-31(16-19-11-7-4-8-12-19)27(35)25-29-15-21(30)24(38-29)22(28(36)37)23(29)26(34)32(25)20(17-33)14-18-9-5-3-6-10-18/h2-12,20-25,33H,1,13-17H2,(H,36,37)/t20-,21?,22+,23-,24+,25+,29-/m1/s1 |
| InChIKey | KDSZSAVWLMKDBK-DBIIUIQFSA-N |
| XLogP | 2.64 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|