C34H40BrN3O5 — CID 23898126
(5R,6R,7S)-2-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898126) has the molecular formula C34H40BrN3O5 and a molecular weight of 650.61 g/mol. Its IUPAC name is (5R,6R,7S)-2-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-2-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898126 |
| Molecular Formula | C34H40BrN3O5 |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | (5R,6R,7S)-2-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)C1N([C@@H](CO)C(C)C)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccccc3)[C@@H]3OC12CC3Br |
| InChI | InChI=1S/C34H40BrN3O5/c1-5-17-36(20-23-13-9-7-10-14-23)33(42)30-34-19-25(35)29(43-34)27(28(34)32(41)38(30)26(21-39)22(3)4)31(40)37(18-6-2)24-15-11-8-12-16-24/h5-16,22,25-30,39H,1-2,17-21H2,3-4H3/t25?,26-,27+,28-,29+,30?,34?/m0/s1 |
| InChIKey | KMBLAUOUBKEINB-BJUICIHPSA-N |
| XLogP | 4.19 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|