C29H38BrN3O5 — CID 23954206
(5R,6S,7R)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23954206) has the molecular formula C29H38BrN3O5 and a molecular weight of 588.54 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23954206 |
| Molecular Formula | C29H38BrN3O5 |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)N(CC=C)C(C)(C)C)C23CC(Br)[C@@H]1O3)c1ccccc1 |
| InChI | InChI=1S/C29H38BrN3O5/c1-7-14-31(19-12-10-9-11-13-19)25(35)21-22-26(36)33(18(3)17-34)24(29(22)16-20(30)23(21)38-29)27(37)32(15-8-2)28(4,5)6/h7-13,18,20-24,34H,1-2,14-17H2,3-6H3/t18-,20?,21+,22+,23+,24?,29?/m1/s1 |
| InChIKey | VFOMQVZGZXQYGZ-YYXIURNKSA-N |
| XLogP | 3.15 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|