C33H38BrN3O5 — CID 23926093
(5R,6R,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23926093) has the molecular formula C33H38BrN3O5 and a molecular weight of 636.59 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23926093 |
| Molecular Formula | C33H38BrN3O5 |
| Molecular Weight | 636.59 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2cc(C)ccc2C)N([C@H](C)CO)C(=O)[C@H]13)c1ccccc1 |
| InChI | InChI=1S/C33H38BrN3O5/c1-6-15-35(23-11-9-8-10-12-23)30(39)26-27-31(40)37(22(5)19-38)29(33(27)18-24(34)28(26)42-33)32(41)36(16-7-2)25-17-20(3)13-14-21(25)4/h6-14,17,22,24,26-29,38H,1-2,15-16,18-19H2,3-5H3/t22-,24?,26-,27+,28-,29?,33?/m1/s1 |
| InChIKey | NOCABQMRZZMQOC-QATGCAGVSA-N |
| XLogP | 4.17 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|