C27H32BrClN2O6 — CID 23924044
but-3-enyl (5R,6S,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23924044) has the molecular formula C27H32BrClN2O6 and a molecular weight of 595.92 g/mol. Its IUPAC name is but-3-enyl (5R,6S,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5R,6S,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23924044 |
| Molecular Formula | C27H32BrClN2O6 |
| Molecular Weight | 595.92 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | but-3-enyl (5R,6S,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)N(CC=C)c3c(C)cccc3Cl)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C27H32BrClN2O6/c1-5-7-12-36-26(35)19-20-24(33)31(16(4)14-32)23(27(20)13-17(28)22(19)37-27)25(34)30(11-6-2)21-15(3)9-8-10-18(21)29/h5-6,8-10,16-17,19-20,22-23,32H,1-2,7,11-14H2,3-4H3/t16-,17?,19+,20+,22+,23?,27?/m1/s1 |
| InChIKey | LTJCIPWZEMSLBC-MCKSCJLOSA-N |
| XLogP | 3.42 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|