C33H36BrClN2O6 — CID 23896018
pent-4-enyl (5R,6R,7S)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23896018) has the molecular formula C33H36BrClN2O6 and a molecular weight of 672.02 g/mol. Its IUPAC name is pent-4-enyl (5R,6R,7S)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6R,7S)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23896018 |
| Molecular Formula | C33H36BrClN2O6 |
| Molecular Weight | 672.02 g/mol |
| Exact Mass | 670.14 |
| IUPAC Name | pent-4-enyl (5R,6R,7S)-8-bromo-2-[(2-chloro-6-methylphenyl)-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2c(C)cccc2Cl)N([C@H](CO)c2ccccc2)C(=O)[C@H]13 |
| InChI | InChI=1S/C33H36BrClN2O6/c1-4-6-10-17-42-32(41)25-26-30(39)37(24(19-38)21-13-8-7-9-14-21)29(33(26)18-22(34)28(25)43-33)31(40)36(16-5-2)27-20(3)12-11-15-23(27)35/h4-5,7-9,11-15,22,24-26,28-29,38H,1-2,6,10,16-19H2,3H3/t22?,24-,25-,26+,28-,29?,33?/m1/s1 |
| InChIKey | DDHQKMLPKJFVDB-AYAKVJIDSA-N |
| XLogP | 5.16 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.02 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|