C28H34BrClN2O6 — CID 23782108
hex-5-enyl (5R,6R,7S)-8-bromo-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23782108) has the molecular formula C28H34BrClN2O6 and a molecular weight of 609.95 g/mol. Its IUPAC name is hex-5-enyl (5R,6R,7S)-8-bromo-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6R,7S)-8-bromo-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23782108 |
| Molecular Formula | C28H34BrClN2O6 |
| Molecular Weight | 609.95 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | hex-5-enyl (5R,6R,7S)-8-bromo-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2ccccc2Cl)N([C@H](C)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C28H34BrClN2O6/c1-4-6-7-10-14-37-27(36)21-22-25(34)32(17(3)16-33)24(28(22)15-18(29)23(21)38-28)26(35)31(13-5-2)20-12-9-8-11-19(20)30/h4-5,8-9,11-12,17-18,21-24,33H,1-2,6-7,10,13-16H2,3H3/t17-,18?,21-,22+,23-,24?,28?/m1/s1 |
| InChIKey | BLTPVFWYSDUJFR-CLRKVCHESA-N |
| XLogP | 3.89 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.95 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|