C28H35BrN2O6 — CID 23951849
pent-4-enyl (5R,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23951849) has the molecular formula C28H35BrN2O6 and a molecular weight of 575.50 g/mol. Its IUPAC name is pent-4-enyl (5R,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23951849 |
| Molecular Formula | C28H35BrN2O6 |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | pent-4-enyl (5R,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)N(CC=C)Cc3ccccc3)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C28H35BrN2O6/c1-4-6-10-14-36-27(35)21-22-25(33)31(18(3)17-32)24(28(22)15-20(29)23(21)37-28)26(34)30(13-5-2)16-19-11-8-7-9-12-19/h4-5,7-9,11-12,18,20-24,32H,1-2,6,10,13-17H2,3H3/t18-,20?,21+,22+,23+,24?,28?/m1/s1 |
| InChIKey | YWMLKOGANZIZGH-QQUUVWJLSA-N |
| XLogP | 2.84 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|