C24H29ClN2O6 — CID 23814507
ethyl (1R,2R,5S,6S,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23814507) has the molecular formula C24H29ClN2O6 and a molecular weight of 476.96 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23814507 |
| Molecular Formula | C24H29ClN2O6 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | ethyl (1R,2R,5S,6S,7S)-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)[C@@H]1N(CCCO)C(=O)[C@H]2[C@H](C(=O)OCC)[C@@H]3CC[C@]12O3)c1ccccc1Cl |
| InChI | InChI=1S/C24H29ClN2O6/c1-3-12-26(16-9-6-5-8-15(16)25)22(30)20-24-11-10-17(33-24)18(23(31)32-4-2)19(24)21(29)27(20)13-7-14-28/h3,5-6,8-9,17-20,28H,1,4,7,10-14H2,2H3/t17-,18+,19+,20-,24+/m0/s1 |
| InChIKey | RTQDBRREORJFCF-YSKXDDPOSA-N |
| XLogP | 2.18 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|