C29H40N2O6 — CID 23954977
ethyl (1R,2R,5S,6S,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23954977) has the molecular formula C29H40N2O6 and a molecular weight of 512.65 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23954977 |
| Molecular Formula | C29H40N2O6 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | ethyl (1R,2R,5S,6S,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)[C@@H]1N(CCCCCCO)C(=O)[C@H]2[C@H](C(=O)OCC)[C@@H]3CC[C@]12O3)c1c(C)cccc1C |
| InChI | InChI=1S/C29H40N2O6/c1-5-16-30(24-19(3)12-11-13-20(24)4)27(34)25-29-15-14-21(37-29)22(28(35)36-6-2)23(29)26(33)31(25)17-9-7-8-10-18-32/h5,11-13,21-23,25,32H,1,6-10,14-18H2,2-4H3/t21-,22+,23+,25-,29+/m0/s1 |
| InChIKey | PBUGWQBJMFANLF-GKVYCCEVSA-N |
| XLogP | 3.31 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|