C31H36N4O9S — CID 23815329
(2S,4S)-2-[2-[2-hydroxyethyl-(4-methoxyphenyl)sulfonylamino]ethoxy]-N-[2-(4-nitroanilino)ethyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23815329) has the molecular formula C31H36N4O9S and a molecular weight of 640.72 g/mol. Its IUPAC name is (2S,4S)-2-[2-[2-hydroxyethyl-(4-methoxyphenyl)sulfonylamino]ethoxy]-N-[2-(4-nitroanilino)ethyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-2-[2-[2-hydroxyethyl-(4-methoxyphenyl)sulfonylamino]ethoxy]-N-[2-(4-nitroanilino)ethyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23815329 |
| Molecular Formula | C31H36N4O9S |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | (2S,4S)-2-[2-[2-hydroxyethyl-(4-methoxyphenyl)sulfonylamino]ethoxy]-N-[2-(4-nitroanilino)ethyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCO)CCO[C@@H]2C[C@H](c3ccccc3)C=C(C(=O)NCCNc3ccc([N+](=O)[O-])cc3)O2)cc1 |
| InChI | InChI=1S/C31H36N4O9S/c1-42-27-11-13-28(14-12-27)45(40,41)34(17-19-36)18-20-43-30-22-24(23-5-3-2-4-6-23)21-29(44-30)31(37)33-16-15-32-25-7-9-26(10-8-25)35(38)39/h2-14,21,24,30,32,36H,15-20,22H2,1H3,(H,33,37)/t24-,30+/m1/s1 |
| InChIKey | WIAIVKLXCNKBCV-HLADLETHSA-N |
| XLogP | 3.25 |
| TPSA | 169.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|