C32H37N5O11S — CID 6668342
methyl 4-[(2R,4R)-2-[2-[2-hydroxyethyl-(4-methoxyphenyl)sulfonylamino]ethoxy]-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate (PubChem CID 6668342) has the molecular formula C32H37N5O11S and a molecular weight of 699.74 g/mol. Its IUPAC name is methyl 4-[(2R,4R)-2-[2-[2-hydroxyethyl-(4-methoxyphenyl)sulfonylamino]ethoxy]-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate.
| Compound Name | methyl 4-[(2R,4R)-2-[2-[2-hydroxyethyl-(4-methoxyphenyl)sulfonylamino]ethoxy]-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
|---|---|
| PubChem CID | 6668342 |
| Molecular Formula | C32H37N5O11S |
| Molecular Weight | 699.74 g/mol |
| Exact Mass | 699.22 |
| IUPAC Name | methyl 4-[(2R,4R)-2-[2-[2-hydroxyethyl-(4-methoxyphenyl)sulfonylamino]ethoxy]-6-[2-[(5-nitro-2-pyridinyl)amino]ethylcarbamoyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C=C(C(=O)NCCNc3ccc([N+](=O)[O-])cn3)O[C@@H](OCCN(CCO)S(=O)(=O)c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C32H37N5O11S/c1-45-26-8-10-27(11-9-26)49(43,44)36(15-17-38)16-18-47-30-20-24(22-3-5-23(6-4-22)32(40)46-2)19-28(48-30)31(39)34-14-13-33-29-12-7-25(21-35-29)37(41)42/h3-12,19,21,24,30,38H,13-18,20H2,1-2H3,(H,33,35)(H,34,39)/t24-,30+/m0/s1 |
| InChIKey | KHEIXXTUATWKOK-QABMSTFYSA-N |
| XLogP | 2.43 |
| TPSA | 208.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.74 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|