C31H35N7O — CID 23818663
N-(3-aminopropyl)-N-[[3-[3-amino-4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 23818663) has the molecular formula C31H35N7O and a molecular weight of 521.67 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[[3-[3-amino-4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-(3-aminopropyl)-N-[[3-[3-amino-4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23818663 |
| Molecular Formula | C31H35N7O |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | N-(3-aminopropyl)-N-[[3-[3-amino-4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | NCCCN(Cc1cccc(-c2ccc(N3CCN(c4ccccn4)CC3)c(N)c2)c1)C(=O)c1cccnc1 |
| InChI | InChI=1S/C31H35N7O/c32-12-5-15-38(31(39)27-8-4-13-34-22-27)23-24-6-3-7-25(20-24)26-10-11-29(28(33)21-26)36-16-18-37(19-17-36)30-9-1-2-14-35-30/h1-4,6-11,13-14,20-22H,5,12,15-19,23,32-33H2 |
| InChIKey | QZIFDUFYDSPLEE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|