C22H27N3O3 — CID 23824676
N-(3-aminopropyl)-N-[[3-[(2-phenoxyacetyl)amino]phenyl]methyl]cyclopropanecarboxamide (PubChem CID 23824676) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[[3-[(2-phenoxyacetyl)amino]phenyl]methyl]cyclopropanecarboxamide.
| Compound Name | N-(3-aminopropyl)-N-[[3-[(2-phenoxyacetyl)amino]phenyl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 23824676 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-(3-aminopropyl)-N-[[3-[(2-phenoxyacetyl)amino]phenyl]methyl]cyclopropanecarboxamide |
| SMILES | NCCCN(Cc1cccc(NC(=O)COc2ccccc2)c1)C(=O)C1CC1 |
| InChI | InChI=1S/C22H27N3O3/c23-12-5-13-25(22(27)18-10-11-18)15-17-6-4-7-19(14-17)24-21(26)16-28-20-8-2-1-3-9-20/h1-4,6-9,14,18H,5,10-13,15-16,23H2,(H,24,26) |
| InChIKey | FJBCRLNKOFZOTC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |