C21H24ClN3O2 — CID 23855130
N-[3-[[3-aminopropyl(cyclopropanecarbonyl)amino]methyl]phenyl]-3-chlorobenzamide (PubChem CID 23855130) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is N-[3-[[3-aminopropyl(cyclopropanecarbonyl)amino]methyl]phenyl]-3-chlorobenzamide.
| Compound Name | N-[3-[[3-aminopropyl(cyclopropanecarbonyl)amino]methyl]phenyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 23855130 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[3-[[3-aminopropyl(cyclopropanecarbonyl)amino]methyl]phenyl]-3-chlorobenzamide |
| SMILES | NCCCN(Cc1cccc(NC(=O)c2cccc(Cl)c2)c1)C(=O)C1CC1 |
| InChI | InChI=1S/C21H24ClN3O2/c22-18-6-2-5-17(13-18)20(26)24-19-7-1-4-15(12-19)14-25(11-3-10-23)21(27)16-8-9-16/h1-2,4-7,12-13,16H,3,8-11,14,23H2,(H,24,26) |
| InChIKey | GTQLIOZMFLYCMJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |