C24H23FN4O4 — CID 23828380
N-(3-aminopropyl)-3-fluoro-N-[[4-[(4-nitrobenzoyl)amino]phenyl]methyl]benzamide (PubChem CID 23828380) has the molecular formula C24H23FN4O4 and a molecular weight of 450.47 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-fluoro-N-[[4-[(4-nitrobenzoyl)amino]phenyl]methyl]benzamide.
| Compound Name | N-(3-aminopropyl)-3-fluoro-N-[[4-[(4-nitrobenzoyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 23828380 |
| Molecular Formula | C24H23FN4O4 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-(3-aminopropyl)-3-fluoro-N-[[4-[(4-nitrobenzoyl)amino]phenyl]methyl]benzamide |
| SMILES | NCCCN(Cc1ccc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C24H23FN4O4/c25-20-4-1-3-19(15-20)24(31)28(14-2-13-26)16-17-5-9-21(10-6-17)27-23(30)18-7-11-22(12-8-18)29(32)33/h1,3-12,15H,2,13-14,16,26H2,(H,27,30) |
| InChIKey | VWWJUZIGHVSMCB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|