C23H28N4O3S — CID 23832751
N-cyclohexyl-2-(1-methylimidazol-2-yl)sulfanyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide (PubChem CID 23832751) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-cyclohexyl-2-(1-methylimidazol-2-yl)sulfanyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide.
| Compound Name | N-cyclohexyl-2-(1-methylimidazol-2-yl)sulfanyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 23832751 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-cyclohexyl-2-(1-methylimidazol-2-yl)sulfanyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)CC(N(C(=O)CSc3nccn3C)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H28N4O3S/c1-16-8-10-18(11-9-16)27-20(28)14-19(22(27)30)26(17-6-4-3-5-7-17)21(29)15-31-23-24-12-13-25(23)2/h8-13,17,19H,3-7,14-15H2,1-2H3 |
| InChIKey | LPLPYZKOAYMHAV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|