C20H16N4O3S — CID 23832855
2-[[3-amino-4-cyano-5-(4-methylanilino)thiophene-2-carbonyl]amino]benzoic acid (PubChem CID 23832855) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[[3-amino-4-cyano-5-(4-methylanilino)thiophene-2-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[3-amino-4-cyano-5-(4-methylanilino)thiophene-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23832855 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[[3-amino-4-cyano-5-(4-methylanilino)thiophene-2-carbonyl]amino]benzoic acid |
| SMILES | Cc1ccc(Nc2sc(C(=O)Nc3ccccc3C(=O)O)c(N)c2C#N)cc1 |
| InChI | InChI=1S/C20H16N4O3S/c1-11-6-8-12(9-7-11)23-19-14(10-21)16(22)17(28-19)18(25)24-15-5-3-2-4-13(15)20(26)27/h2-9,23H,22H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | GTRMGMMHYLNDEI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_B(12)', 'substructure': 'N/A'} |
|---|